|
|
| | 4′-Methylbiphenyl-2-carboxylic acid methyl ester Basic information |
| | 4′-Methylbiphenyl-2-carboxylic acid methyl ester Chemical Properties |
| Melting point | 60-61°C | | Boiling point | 359.4±21.0 °C(Predicted) | | density | 1.083±0.06 g/cm3(Predicted) | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C15H14O2/c1-11-7-9-12(10-8-11)13-5-3-4-6-14(13)15(16)17-2/h3-10H,1-2H3 | | InChIKey | IHNIAWHITVGYJJ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C)C=C2)=CC=CC=C1C(OC)=O | | CAS DataBase Reference | 114772-34-8(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | WGK 3 | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids |
| | 4′-Methylbiphenyl-2-carboxylic acid methyl ester Usage And Synthesis |
| Description | 4′-Methylbiphenyl-2-carboxylic acid methyl ester is an important pharmaceutical intermediate compound used as an organic synthetic material in the preparation of temesartan. Timosartan is an angiotensin II receptor blocker (ARB) used to treat hypertension. | | Chemical Properties | White or almost white crystalline powder | | Uses | Methyl 2-(p-Tolyl)benzoate is an intermediate in the synthesis of Telmisartan (T017000) analogs. |
| | 4′-Methylbiphenyl-2-carboxylic acid methyl ester Preparation Products And Raw materials |
|