- Tenuifolin
-
- $41.00 / 5mg
-
2026-03-13
- CAS:20183-47-5
- Min. Order:
- Purity: 97.37%
- Supply Ability: 10g
- Tenuifolin
-
- $0.00 / 20mg
-
2023-02-24
- CAS:20183-47-5
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | 2β,27-Dihydroxy-3β-(β-D-glucopyranosyloxy)oleana-12-ene-23,28-dioic acid Basic information |
| Product Name: | 2β,27-Dihydroxy-3β-(β-D-glucopyranosyloxy)oleana-12-ene-23,28-dioic acid | | Synonyms: | (4S)-3β-(β-D-Glucopyranosyloxy)-2β,27-dihydroxyolean-12-ene-23,28-dioic acid;Tenuifoline;2β,27-Dihydroxy-3β-(β-D-glucopyranosyloxy)oleana-12-ene-23,28-dioic acid;3β-(β-D-Glucopyranosyloxy)-2β,27-dihydroxyoleana-12-ene-23,28-dioic acid;Tenuifolin;2beta,27-Dihydroxy-3beta-(beta-D-glucopyranosyloxy)oleana-12-ene-23,28-dioic acid;Tenuifolin, >=98%;Tenuifolin, 98%, from Polygala tenuifolia Willd. | | CAS: | 20183-47-5 | | MF: | C36H56O12 | | MW: | 680.83 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 20183-47-5.mol |  |
| | 2β,27-Dihydroxy-3β-(β-D-glucopyranosyloxy)oleana-12-ene-23,28-dioic acid Chemical Properties |
| Melting point | 201-204℃ | | Boiling point | 853.6±65.0 °C(Predicted) | | density | 1.39 | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly), Pyridine (Slightly) | | pka | 4.15±0.70(Predicted) | | form | Solid | | color | White to Off-White | | Water Solubility | slightly soluble in water | | Stability: | Hygroscopic | | Major Application | food and beverages | | InChIKey | DBJLNNAUDGIUAE-YRAPYSFMNA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)OC2[C@@](C3[C@@](C4[C@]([C@@]5(CCC6(C(CC(CC6)(C)C)C5=CC4)C(=O)O)CO)(CC3)C)(CC2O)C)(C)C(=O)O |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29389090 | | Storage Class | 11 - Combustible Solids |
| | 2β,27-Dihydroxy-3β-(β-D-glucopyranosyloxy)oleana-12-ene-23,28-dioic acid Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in methanol, derived from Polygala tenuifolia. | | Uses | Tenuifolin is a terpenoid with potential to treat Alzheimer’s disease. | | in vivo | Tenuifolin (20-80 mg/kg; po; single dose) induces beneficial effects on learning and memory, prevents loss and apoptosis of neurons in APP/PS1 mice[2].
| | IC 50 | AChE |
| | 2β,27-Dihydroxy-3β-(β-D-glucopyranosyloxy)oleana-12-ene-23,28-dioic acid Preparation Products And Raw materials |
|