|
|
| | 5-CYANOOXINDOLE Basic information |
| | 5-CYANOOXINDOLE Chemical Properties |
| Melting point | 236-239°C | | Boiling point | 389.7±42.0 °C(Predicted) | | density | 1.33 | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 12.84±0.20(Predicted) | | color | Off White | | InChI | InChI=1S/C9H6N2O/c10-5-6-1-2-8-7(3-6)4-9(12)11-8/h1-3H,4H2,(H,11,12) | | InChIKey | NZOSLRYUVHMXTQ-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(C#N)C=C2)CC1=O |
| | 5-CYANOOXINDOLE Usage And Synthesis |
| Uses | 2-Oxoindoline-5-carbonitrile is used as a reactant in the preparation of indolinone-based kinase inhibitors. |
| | 5-CYANOOXINDOLE Preparation Products And Raw materials |
|