|
|
| | 2,6-Dimethylbiphenyl-4-ol Basic information |
| | 2,6-Dimethylbiphenyl-4-ol Chemical Properties |
| Boiling point | 301.6±11.0 °C(Predicted) | | density | 1.067±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | 10.11±0.23(Predicted) | | form | solid | | InChI | 1S/C14H14O/c1-10-4-3-5-11(2)14(10)12-6-8-13(15)9-7-12/h3-9,15H,1-2H3 | | InChIKey | MAFZFBHMTZMCID-UHFFFAOYSA-N | | SMILES | OC1=CC=C(C=C1)C2=C(C)C=CC=C2C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Dam. 1 |
| | 2,6-Dimethylbiphenyl-4-ol Usage And Synthesis |
| | 2,6-Dimethylbiphenyl-4-ol Preparation Products And Raw materials |
|