|
|
| | 2,4-Dimethyldiphenylamine Basic information |
| Product Name: | 2,4-Dimethyldiphenylamine | | Synonyms: | 2,4-DIMETHYLDIPHENYLAMINE;PHENYL(2,4-XYLYL)AMINE;N-PHENYL-2,4-XYLIDINE;N-Phenyl-2,4-xylidine
Phenyl(2,4-xylyl)amine;2,4-DiMethyl-N-phenylaniline;TRIS(4-BROMOPHENYL)2,4-DIMETHYL DIPHENYLAMINE;2,4-DiMethyl-N-phenylbenzenaMine;N-(2,4-dimethylphenyl)aniline | | CAS: | 25078-04-0 | | MF: | C14H15N | | MW: | 197.28 | | EINECS: | 677-190-2 | | Product Categories: | | | Mol File: | 25078-04-0.mol |  |
| | 2,4-Dimethyldiphenylamine Chemical Properties |
| Melting point | 43°C | | Boiling point | 170°C 3mm | | density | 1.049±0.06 g/cm3(Predicted) | | Fp | 0°C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Methanol | | pka | 1.11±0.40(Predicted) | | form | powder to lump | | color | White to Yellow | | InChI | InChI=1S/C14H15N/c1-11-8-9-14(12(2)10-11)15-13-6-4-3-5-7-13/h3-10,15H,1-2H3 | | InChIKey | BWYYRZBQXLCZJL-UHFFFAOYSA-N | | SMILES | C1(NC2=CC=CC=C2)=CC=C(C)C=C1C |
| | 2,4-Dimethyldiphenylamine Usage And Synthesis |
| Chemical Properties | white crystalline. | | Uses | 2,4-Dimethyldiphenylamine is mainly used in organic synthesis and pharmaceutical intermediates. | | Synthesis | GENERAL STEPS: A solution of potassium tert-butoxide (KOtBu, 102.1 mg, 1.3 eq.) and complex 3a (10-50 mL, 0.01-0.05 mol, prepared from 4.6 mg of complex 3a dissolved in 1.0 mL of dichloromethane) was added to a Schlenk reaction tube under nitrogen atmosphere. The reaction tube was sealed and the solvent was removed under reduced pressure. Toluene (0.5 mL), 2,4-dimethylaniline (0.84 mmol) and chlorobenzene (0.70 mmol) were then added sequentially. The reaction mixture was stirred vigorously at the indicated temperature for 3 to 24 hours. Upon completion of the reaction, the solvent was removed under reduced pressure and the residue was purified by silica gel column chromatography to afford the target product 2,4-dimethyldiphenylamine. | | References | [1] Advanced Synthesis and Catalysis, 2008, vol. 350, # 5, p. 652 - 656
[2] Tetrahedron, 2017, vol. 73, # 52, p. 7308 - 7314 |
| | 2,4-Dimethyldiphenylamine Preparation Products And Raw materials |
|