| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | 2-Deoxystreptamine, dihydrobromide Basic information |
| Product Name: | 2-Deoxystreptamine, dihydrobromide | | Synonyms: | 2-DOS 2HBR;4T,6T-DIAMINOCYCLOHEXANE-1R,2T,3C-TRIOL DIHYDROBROMIDE;GentaMycin IMpurity E (2-DeoxystreptaMine) 2HBr;2-Deoxystreptamine dihydrobromide >=97% (TLC);(1S,3R,4S,6R)-4,6-diaminocyclohexane-1,2,3-triol,dihydrobromide;Gentamycin Sulfate Impurity 5;Gentamicine Sulphate EP Impurity E;Gentamicin Sulfate EP Impurity E DiHBr (2-Deoxystreptamine DiHBr) | | CAS: | 84107-26-6 | | MF: | C6H15BrN2O3 | | MW: | 243.1 | | EINECS: | | | Product Categories: | | | Mol File: | 84107-26-6.mol |  |
| | 2-Deoxystreptamine, dihydrobromide Chemical Properties |
| storage temp. | 2-8°C | | solubility | Methanol (Slightly, Heated), Water (Slightly) | | form | powder | | color | Off-white to beige | | BRN | 3692825 | | InChI | 1S/C6H14N2O3.2BrH/c7-2-1-3(8)5(10)6(11)4(2)9;;/h2-6,9-11H,1,7-8H2;2*1H/t2-,3+,4+,5-,6-;; | | InChIKey | FQPOWLZRZNUTOR-SKIYRPIFSA-N | | SMILES | Br.Br.N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O)[C@@H]1O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2922190090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Deoxystreptamine, dihydrobromide Usage And Synthesis |
| Uses | An important component of several aminocyclitol antibiotics. |
| | 2-Deoxystreptamine, dihydrobromide Preparation Products And Raw materials |
|