|
|
| | 2,3-DIMETHYL-2H-INDAZOL-6-AMINE Basic information |
| Product Name: | 2,3-DIMETHYL-2H-INDAZOL-6-AMINE | | Synonyms: | 2,3-DIMETHYL-2H-INDAZOL-6-AMINE;6-Amino-2,3-dimethyl-2H-i...;6-Amino-2,3-dimethyl-2H-indazole;2,3-dimethyl-2H-indazol-6-ylamine;2,3-Dimethyl-6-amino-2H-indazole;3-Dimethyl-2H-indazol-6-amine;2H-Indazol-6-aMine, 2,3-diMethyl-;2,3-dimethyl-6-indazolamine | | CAS: | 444731-72-0 | | MF: | C9H11N3 | | MW: | 161.2 | | EINECS: | | | Product Categories: | | | Mol File: | 444731-72-0.mol |  |
| | 2,3-DIMETHYL-2H-INDAZOL-6-AMINE Chemical Properties |
| Boiling point | 366.9±22.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 4.20±0.30(Predicted) | | form | Solid | | color | Dark Brown to Very Dark Orange | | InChI | InChI=1S/C9H11N3/c1-6-8-4-3-7(10)5-9(8)11-12(6)2/h3-5H,10H2,1-2H3 | | InChIKey | PVNVSSNARYHLRF-UHFFFAOYSA-N | | SMILES | N1=C2C(C=CC(N)=C2)=C(C)N1C |
| | 2,3-DIMETHYL-2H-INDAZOL-6-AMINE Usage And Synthesis |
| Uses | 2,3-Dimethyl-6-amino-2H-indazole is an impurity in the synthesis of Pazopanib (P210925) hydrochloride, an oral angiogenesis inhibitor targeting VEGFR and PDGFR. |
| | 2,3-DIMETHYL-2H-INDAZOL-6-AMINE Preparation Products And Raw materials |
|