|
|
| | N-Methyl-4-nitrophenethylamine hydrochloride Basic information |
| | N-Methyl-4-nitrophenethylamine hydrochloride Chemical Properties |
| Melting point | 222-227 °C | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO, Methanol | | form | Solid | | color | White to Light Yellow | | InChI | InChI=1S/C9H12N2O2.ClH/c1-10-7-6-8-2-4-9(5-3-8)11(12)13;/h2-5,10H,6-7H2,1H3;1H | | InChIKey | VGJDSNZOPPZCTB-UHFFFAOYSA-N | | SMILES | C1C=C(CCNC)C=CC=1[N+]([O-])=O.Cl |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N-Methyl-4-nitrophenethylamine hydrochloride Usage And Synthesis |
| Uses | N-Methyl-2-(4-nitrophenyl)ethanamine Hydrochloride is used as a reactant in the preparation of small molecule CDC25 phosphatases inhibitors. |
| | N-Methyl-4-nitrophenethylamine hydrochloride Preparation Products And Raw materials |
|