| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-(2-Oxo-propyl)-benzoic acid methyl ester Basic information |
| | 4-(2-Oxo-propyl)-benzoic acid methyl ester Chemical Properties |
| Boiling point | 295.1±23.0 °C(Predicted) | | density | 1.106±0.06 g/cm3(Predicted) | | form | powder | | InChI | 1S/C11H12O3/c1-8(12)7-9-3-5-10(6-4-9)11(13)14-2/h3-6H,7H2,1-2H3 | | InChIKey | MMLNFWPLMKLQFK-UHFFFAOYSA-N | | SMILES | COC(C1=CC=C(CC(C)=O)C=C1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-(2-Oxo-propyl)-benzoic acid methyl ester Usage And Synthesis |
| | 4-(2-Oxo-propyl)-benzoic acid methyl ester Preparation Products And Raw materials |
|