| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1-(tert-butoxycarbonyl)-4-oxopiperidine-2-carboxylic acid Basic information |
| Product Name: | 1-(tert-butoxycarbonyl)-4-oxopiperidine-2-carboxylic acid | | Synonyms: | (S)-1-Boc-4-oxopiperidine-2-carboxylic acid 95%;(2S)-4-oxo-1,2-Piperidinedicarboxylic acid 1-(1,1-dimethylethyl) ester;(S)-1-N-Boc-4-oxo-piperidine-2-carboxylic acid;1-(tert-butoxycarbonyl)-4-oxopiperidine-2-carboxylic acid;(S)-1-Boc-4-oxopiperidine-2-carboxylic acid;(2S)-4-Oxopiperidine-2-carboxylic acid, N-BOC protected 97%;1,2-Piperidinedicarboxylic acid, 4-oxo-, 1-(1,1-diMethylethyl) ester, (2S)-;(2S)-1-(tert-Butoxycarbonyl)-4-oxopiperidine-2-carboxylic acid, 4-Oxo-L-pipecolinic acid, N-BOC protected | | CAS: | 198646-60-5 | | MF: | C11H17NO5 | | MW: | 243.26 | | EINECS: | | | Product Categories: | | | Mol File: | 198646-60-5.mol |  |
| | 1-(tert-butoxycarbonyl)-4-oxopiperidine-2-carboxylic acid Chemical Properties |
| Melting point | 121-126℃ | | Boiling point | 403.6±45.0 °C(Predicted) | | density | 1.257±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble (12 g/L) (25°C) | | form | powder | | pka | 3.95±0.20(Predicted) | | color | White | | Optical Rotation | [α]22/D -18.5°, c = 1 in chloroform | | Sensitive | Air & Moisture Sensitive | | Major Application | peptide synthesis | | InChI | InChI=1S/C11H17NO5/c1-11(2,3)17-10(16)12-5-4-7(13)6-8(12)9(14)15/h8H,4-6H2,1-3H3,(H,14,15)/t8-/m0/s1 | | InChIKey | GPBCBXYUAJQMQM-QMMMGPOBSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(=O)C[C@H]1C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 1-(tert-butoxycarbonyl)-4-oxopiperidine-2-carboxylic acid Usage And Synthesis |
| Uses | It is a fine chemical and synthetic intermediate. |
| | 1-(tert-butoxycarbonyl)-4-oxopiperidine-2-carboxylic acid Preparation Products And Raw materials |
|