|
|
| | (3R,3aS,6aR)-hexahydrofuro[2,3-b]furan-3-ol Basic information |
| Product Name: | (3R,3aS,6aR)-hexahydrofuro[2,3-b]furan-3-ol | | Synonyms: | (3R,3aS,6aR)-hexahydrofuro[2,3-b]furan-3-ol;(3R, 3aS, 6aS)-hexahydrofuro[2,3-b]furan-3-ol;(3R)-hexahydrofuro[2,3-b]furan-3-ol;3-hydroxy-(3R,3αS,6αR)-bis-tetrahydrofuran;Furo[2,3-b]furan-3-ol, hexahydro-, (3R,3aS,6aR;HEXAHYDRO-(3R,3AS,6AR)-FURO(2,3-B)FURAN-3-OL;(3R,3aS,6aR);3-hydroxy-(3R,3±S,6±R)-bis-tetrahydrofuran | | CAS: | 156928-09-5 | | MF: | C6H10O3 | | MW: | 130.14 | | EINECS: | 605-076-4 | | Product Categories: | | | Mol File: | 156928-09-5.mol | ![(3R,3aS,6aR)-hexahydrofuro[2,3-b]furan-3-ol Structure](CAS/GIF/156928-09-5.gif) |
| | (3R,3aS,6aR)-hexahydrofuro[2,3-b]furan-3-ol Chemical Properties |
| Boiling point | 251.5±20.0 °C(Predicted) | | density | 1.275 | | vapor pressure | 0.19Pa at 25℃ | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly, Heated) | | form | Oil | | pka | 14.07±0.20(Predicted) | | color | Pale Yellow | | InChI | InChI=1S/C6H10O3/c7-5-3-9-6-4(5)1-2-8-6/h4-7H,1-3H2/t4-,5-,6+/m0/s1 | | InChIKey | RCDXYCHYMULCDZ-HCWXCVPCSA-N | | SMILES | O1C[C@H](O)[C@]2([H])CCO[C@]12[H] | | LogP | 1.055 at pH5 |
| | (3R,3aS,6aR)-hexahydrofuro[2,3-b]furan-3-ol Usage And Synthesis |
| Uses | (3R,3aS,6aR)-Hexahydrofuro[2,3-b]furan-3-ol is used as a reagent in the synthesis of Darunavir (D193500); a second generation HIV-1-protease inhibitor and antiviral agent. |
| | (3R,3aS,6aR)-hexahydrofuro[2,3-b]furan-3-ol Preparation Products And Raw materials |
| Raw materials | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol-->2-Furanol, 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]tetrahydro-, (3S)--->809286-93-9-->(3S,3aS,6aR)-Hexahydrofuro[2,3-b]furan-3-ol-->Vinyl acetate | | Preparation Products | (3S,3aR,6aS)-Hexahydrofuro[2,3-b]furan-3-ol |
|