| Company Name: |
SynAsst Chemical.
|
| Tel: |
021-60343070 |
| Email: |
|
| Products Intro: |
Product Name:2-BroMo-6-iodopyridin-3-yl tert-butyl carbonate
CAS:1087659-26-4
Purity:96%Min Package:10g 100g 500g
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:2-Bromo-6-iodopyridin-3-yltert-butylcarbonate
CAS:1087659-26-4
Purity:NULL Package:100mg;250mg;25mg;50mg Remarks:NULL
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:2-Bromo-6-iodopyridin-3-yl tert-butyl carbonate
CAS:1087659-26-4
|
|
| | 2-Bromo-6-iodopyridin-3-yl tert-butyl carbonate Basic information |
| | 2-Bromo-6-iodopyridin-3-yl tert-butyl carbonate Chemical Properties |
| form | solid | | InChI | 1S/C10H11BrINO3/c1-10(2,3)16-9(14)15-6-4-5-7(12)13-8(6)11/h4-5H,1-3H3 | | InChIKey | NTCCNGUKLGPNQT-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)Oc1ccc(I)nc1Br |
| WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 2-Bromo-6-iodopyridin-3-yl tert-butyl carbonate Usage And Synthesis |
| | 2-Bromo-6-iodopyridin-3-yl tert-butyl carbonate Preparation Products And Raw materials |
|