|
|
| | 2-Propenoic acid 2-(2-naphthalenylthio)ethyl ester Basic information |
| Product Name: | 2-Propenoic acid 2-(2-naphthalenylthio)ethyl ester | | Synonyms: | 2-Naphthalenylthioethyl acrylate;2-Propenoic acid 2-(2-naphthalenylthio)ethyl ester;Naphthalenylthioethyl acrylate;2-(2-Naphthylsulfanyl)ethyl acrylate;2-(2-Naphthalenylthio)ethyl?acrylate;NTEA;2-Acrylic acid 2-(2-naphthio) ester;2-(Naphthalen-2-ylthio)ethyl acrylate | | CAS: | 897049-32-0 | | MF: | C15H14O2S | | MW: | 258.34 | | EINECS: | | | Product Categories: | | | Mol File: | 897049-32-0.mol |  |
| | 2-Propenoic acid 2-(2-naphthalenylthio)ethyl ester Chemical Properties |
| Boiling point | 412.9±28.0 °C(Predicted) | | density | 1.18 | | InChI | InChI=1S/C15H14O2S/c1-2-15(16)17-9-10-18-14-8-7-12-5-3-4-6-13(12)11-14/h2-8,11H,1,9-10H2 | | InChIKey | TVQDRZGNLJFEQK-UHFFFAOYSA-N | | SMILES | C(OCCSC1=CC=C2C(=C1)C=CC=C2)(=O)C=C |
| | 2-Propenoic acid 2-(2-naphthalenylthio)ethyl ester Usage And Synthesis |
| | 2-Propenoic acid 2-(2-naphthalenylthio)ethyl ester Preparation Products And Raw materials |
|