|
|
| | 4-Bromo-5,8-difluoroquinoline Basic information |
| | 4-Bromo-5,8-difluoroquinoline Chemical Properties |
| form | solid | | InChI | 1S/C9H4BrF2N/c10-5-3-4-13-9-7(12)2-1-6(11)8(5)9/h1-4H | | InChIKey | UOFCLTOADUYCLV-UHFFFAOYSA-N | | SMILES | FC1=CC=C(F)C2=NC=CC(Br)=C21 |
| Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 4-Bromo-5,8-difluoroquinoline Usage And Synthesis |
| | 4-Bromo-5,8-difluoroquinoline Preparation Products And Raw materials |
|