|
|
| | 4-Bromomethyl-3-fluorophenylboronic acid,pinacol Basic information |
| Product Name: | 4-Bromomethyl-3-fluorophenylboronic acid,pinacol | | Synonyms: | 4-Bromomethyl-3-fluorophenylboronic acid,pinacol;4-(Bromomethyl)-3-fluorobenzeneboronic acid, pinacol ester;2-[4-(Bromomethyl)-3-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;4-Bromomethyl-3-fluorophenylboronic acid, pinacol ester;4-Bromomethyl-3-fluorophenylboronic acid;2-(4-(Bromomethyl);-3-fluorophenyl);4-Bromomethyl-3- | | CAS: | 1150271-74-1 | | MF: | C13H17BBrFO2 | | MW: | 314.99 | | EINECS: | | | Product Categories: | | | Mol File: | 1150271-74-1.mol |  |
| | 4-Bromomethyl-3-fluorophenylboronic acid,pinacol Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H17BBrFO2/c1-12(2)13(3,4)18-14(17-12)10-6-5-9(8-15)11(16)7-10/h5-7H,8H2,1-4H3 | | InChIKey | OOTPRFIHAFABSN-UHFFFAOYSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1C1=CC=C(CBr)C(F)=C1 |
| | 4-Bromomethyl-3-fluorophenylboronic acid,pinacol Usage And Synthesis |
| Uses | 4-Bromomethyl-3-fluorophenylboronic acid, pinacol ester |
| | 4-Bromomethyl-3-fluorophenylboronic acid,pinacol Preparation Products And Raw materials |
|