Methyl 2-amino-3-methylbenzoate manufacturers
- 2-Amino-N,3-dimethylbenzamide
-
- $3.00 / 25KG
-
2025-10-13
- CAS:870997-57-2
- Min. Order: 0.1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | Methyl 2-amino-3-methylbenzoate Basic information |
| Product Name: | Methyl 2-amino-3-methylbenzoate | | Synonyms: | 2-Amino-3-methyl-N-methylbenzamide;2-amino-N,3-dimethylbenzamide(SALTDATA: FREE);2-amino-3,N-dimethyl-benzamide;2-AMINO-N,3-DIMETHYLBENZAMIDE 95%;Benzamide, 2-amino-N,3-dimethyl- | | CAS: | 870997-57-2 | | MF: | C9H12N2O | | MW: | 164.2 | | EINECS: | 218-362-5 | | Product Categories: | | | Mol File: | 870997-57-2.mol |  |
| | Methyl 2-amino-3-methylbenzoate Chemical Properties |
| Melting point | 115-117 °C | | Boiling point | 309.8±35.0 °C(Predicted) | | density | 1.106±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 15.22±0.46(Predicted) | | Appearance | White to light brown Solid | | InChI | InChI=1S/C9H12N2O/c1-6-4-3-5-7(8(6)10)9(12)11-2/h3-5H,10H2,1-2H3,(H,11,12) | | InChIKey | FBOWFVWOCBTBPH-UHFFFAOYSA-N | | SMILES | C(NC)(=O)C1=CC=CC(C)=C1N |
| | Methyl 2-amino-3-methylbenzoate Usage And Synthesis |
| | Methyl 2-amino-3-methylbenzoate Preparation Products And Raw materials |
|