|
|
| | Tert-Butyl3-((methylamino)methyl)azetidine-1-carboxylate Basic information |
| Product Name: | Tert-Butyl3-((methylamino)methyl)azetidine-1-carboxylate | | Synonyms: | Tert-Butyl3-((methylamino)methyl)azetidine-1-carboxylate;3-[(Methylamino)methyl]azetidine, N1-BOC protected;1-Boc-3-((MethylaMino)Met...;3-[(Methylamino)methyl]azetidine-1-carboxylic acid tert-butyl ester;tert-Butyl 3-[(methylamino)methyl]azetidine-1-carboxylate, tert-Butyl 3-[(methylamino)methyl]azetane-1-carboxylate;3-[(Methylamino)methyl]-1-Boc-azetidine;3-(methylaminomethyl)-1-azetidinecarboxylic acid tert-butyl ester;1-Azetidinecarboxylic acid, 3-[(methylamino)methyl]-, 1,1-dimethylethyl ester | | CAS: | 1049730-81-5 | | MF: | C10H20N2O2 | | MW: | 200.28 | | EINECS: | | | Product Categories: | | | Mol File: | 1049730-81-5.mol |  |
| | Tert-Butyl3-((methylamino)methyl)azetidine-1-carboxylate Chemical Properties |
| Boiling point | 262℃ | | density | 1.023 | | Fp | 112℃ | | storage temp. | 2-8°C | | pka | 10.23±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-8(7-12)5-11-4/h8,11H,5-7H2,1-4H3 | | InChIKey | LNDGYTKISRFVOI-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC(CNC)C1 |
| | Tert-Butyl3-((methylamino)methyl)azetidine-1-carboxylate Usage And Synthesis |
| Uses | It is used as an active pharmaceutical intermediate. |
| | Tert-Butyl3-((methylamino)methyl)azetidine-1-carboxylate Preparation Products And Raw materials |
|