|
|
| | 4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride Basic information |
| Product Name: | 4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride | | Synonyms: | 4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride;4-(3-(dibutylamino)propoxy)benzoic acid HCL;4-(3-(dibutylamino)propoxy)benzoic acid hydrochlorideQ: What is
4-(3-(dibutylamino)propoxy)benzoic acid hydrochloride Q: What is the CAS Number of
4-(3-(dibutylamino)propoxy)benzoic acid hydrochloride Q: What is the storage condition of
4-(3-(dibutylamino)propoxy)benzoic acid hydrochloride;DronedaroneImpurity20HCl;Dronedarone Impurity 15;Dronedarone Impurity 8 HCl;Dronedarone impurity 25 (hydrochloride) | | CAS: | 437651-44-0 | | MF: | C18H29NO3.HCl | | MW: | 343.89 | | EINECS: | | | Product Categories: | Amines;Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals;API | | Mol File: | 437651-44-0.mol | ![4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride Structure](CAS2/GIF/437651-44-0.gif) |
| | 4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride Chemical Properties |
| Melting point | 155-157°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Pale Beige | | InChI | InChI=1S/C18H29NO3.ClH/c1-3-5-12-19(13-6-4-2)14-7-15-22-17-10-8-16(9-11-17)18(20)21;/h8-11H,3-7,12-15H2,1-2H3,(H,20,21);1H | | InChIKey | HEXBWGNCINCLCP-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(OCCCN(CCCC)CCCC)C=C1.[H]Cl |
| | 4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Dronedarone (D679445) intermediate. |
| | 4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride Preparation Products And Raw materials |
|