|
|
| | ethyl 2-amino-4,5,6,7-tetrahydrobenzo[d]thiazole-6-carboxylate Basic information |
| Product Name: | ethyl 2-amino-4,5,6,7-tetrahydrobenzo[d]thiazole-6-carboxylate | | Synonyms: | ethyl 2-amino-4,5,6,7-tetrahydrobenzo[d]thiazole-6-carboxylate;2-Amino-4,5,6,7-tetrahydrobenzothiazole-6-carboxylic acid ethyl ester;Ethyl 2-Amino-4,5,6,7-tetrahydrobenzothiazole-6-carboxylate;6-Benzothiazolecarboxylic acid, 2-amino-4,5,6,7-tetrahydro-, ethyl ester | | CAS: | 134136-00-8 | | MF: | C10H14N2O2S | | MW: | 226.3 | | EINECS: | | | Product Categories: | | | Mol File: | 134136-00-8.mol | ![ethyl 2-amino-4,5,6,7-tetrahydrobenzo[d]thiazole-6-carboxylate Structure](CAS2/GIF/134136-00-8.gif) |
| | ethyl 2-amino-4,5,6,7-tetrahydrobenzo[d]thiazole-6-carboxylate Chemical Properties |
| Boiling point | 380.9±30.0 °C(Predicted) | | density | 1.290±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 5.40±0.40(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C10H14N2O2S/c1-2-14-9(13)6-3-4-7-8(5-6)15-10(11)12-7/h6H,2-5H2,1H3,(H2,11,12) | | InChIKey | SEWZIOVTGXEYEZ-UHFFFAOYSA-N | | SMILES | S1C2CC(C(OCC)=O)CCC=2N=C1N |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | HazardClass | IRRITANT | | HS Code | 2934208090 |
| | ethyl 2-amino-4,5,6,7-tetrahydrobenzo[d]thiazole-6-carboxylate Usage And Synthesis |
| | ethyl 2-amino-4,5,6,7-tetrahydrobenzo[d]thiazole-6-carboxylate Preparation Products And Raw materials |
|