|
|
| | (1R,4S)-tert-butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate Basic information |
| Product Name: | (1R,4S)-tert-butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate | | Synonyms: | 7-Boc-2-oxo-7-azabicyclo[2.2.1]heptane;2-Oxo-7-aza-bicyclo[2.2.1]heptane-7-carboxylic acid tert-butyl ester;7-Azabicyclo[2.2.1]heptane-7-carboxylic acid, 2-oxo-,1,1-dimethylethyl ester;1H-pyrrolo[2,3-b]pyridinebicyclo[2.2.1]heptane-7-carboxylic acid, 2-oxo-,1,1-dimethylethyl ester;tert-butyl (1R,4S)-3-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate;tert-butyl 3-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate;2-Oxo-7-Azabicyclo[2.2.1]heptane-7-carboxylic acid 1,1-dimethylethyl ester;tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate | | CAS: | 152533-47-6 | | MF: | C11H17NO3 | | MW: | 211.26 | | EINECS: | | | Product Categories: | | | Mol File: | 152533-47-6.mol | ![(1R,4S)-tert-butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate Structure](CAS2/GIF/152533-47-6.gif) |
| | (1R,4S)-tert-butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate Chemical Properties |
| Boiling point | 308.2±25.0 °C(Predicted) | | density | 1.173±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | -1.82±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H17NO3/c1-11(2,3)15-10(14)12-7-4-5-8(12)9(13)6-7/h7-8H,4-6H2,1-3H3 | | InChIKey | XWIJVOQGKJHEAJ-UHFFFAOYSA-N | | SMILES | C12N(C(OC(C)(C)C)=O)C(CC1)CC2=O |
| | (1R,4S)-tert-butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate Usage And Synthesis |
| Uses | 7-Boc-2-oxo-7-azabicyclo[2.2.1]heptane is used in the preparation of epiboxidine enantiomers and analogs with binding affinity at α4β2 and α7 neuronal nicotinic acetylcholine receptors via resolution and Suzuki cross-coupling reactions. |
| | (1R,4S)-tert-butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate Preparation Products And Raw materials |
|