| Company Name: |
ChemShuttle, Inc. |
| Tel: |
83588313 18800520310 |
| Email: |
sales@chemshuttle.com |
|
| | 7-Bromo-3,4-dichloroquinoline Basic information |
| | 7-Bromo-3,4-dichloroquinoline Chemical Properties |
| form | solid | | InChI | 1S/C9H4BrCl2N/c10-5-1-2-6-8(3-5)13-4-7(11)9(6)12/h1-4H | | InChIKey | HRUWRHDAJXUPON-UHFFFAOYSA-N | | SMILES | ClC1=C(Cl)C=NC2=CC(Br)=CC=C21 |
| Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HS Code | 2933499090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 4 Eye Dam. 1 |
| | 7-Bromo-3,4-dichloroquinoline Usage And Synthesis |
| | 7-Bromo-3,4-dichloroquinoline Preparation Products And Raw materials |
|