| Company Name: |
BioBioPha Co., Ltd.
|
| Tel: |
0871-65217109 13211707573; |
| Email: |
y.liu@mail.biobiopha.com |
| Products Intro: |
Product Name:13-O-p-Coumaroylplumieride
CAS:80416-52-0
Purity:97.5% Package:5mg Remarks:BBP01952
|
13-O-p-Coumaroylplumieride manufacturers
|
| | 13-O-p-Coumaroylplumieride Basic information |
| Product Name: | 13-O-p-Coumaroylplumieride | | Synonyms: | 13-O-p-Coumaroylplumieride;Plumeride p-coumarate;Spiro[cyclopenta[c]pyran-7(1H),2'(5'H)-furan]-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-4a,7a-dihydro-4'-[1-[[3-(4-hydroxyphenyl)-1-oxo-2-propenyl]oxy]ethyl]-5'-oxo-, methyl ester, [1S-[1α,4aα,7α(R*),7aα]]- (9CI);13-O-p-coumaroylplumeride | | CAS: | 80416-52-0 | | MF: | C30H32O14 | | MW: | 616.57 | | EINECS: | | | Product Categories: | | | Mol File: | 80416-52-0.mol |  |
| | 13-O-p-Coumaroylplumieride Chemical Properties |
| Boiling point | 870.9±65.0 °C(Predicted) | | density | 1.55±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 8.57±0.15(Predicted) | | form | solid | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChIKey | WBCMGDNFDRNGGZ-DEYYTONKSA-N | | SMILES | COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H]3[C@@H]1C=C[C@]34OC(=O)C(=C4)[C@H](C)OC(=O)\C=C\c5ccc(O)cc5 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 13-O-p-Coumaroylplumieride Usage And Synthesis |
| Uses | metabolomics
vitamins, nutraceuticals, and natural products |
| | 13-O-p-Coumaroylplumieride Preparation Products And Raw materials |
|