Viscidulin I manufacturers
- Viscidulin I
-
- $165.00 / 1mg
-
2026-01-26
- CAS:92519-95-4
- Min. Order:
- Purity: 99.69%
- Supply Ability: 10g
|
| | Viscidulin I Basic information |
| Product Name: | Viscidulin I | | Synonyms: | Viscidulin I;2-(2,6-Dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one;4H-1-Benzopyran-4-one,2-(2,6-dihydroxyphenyl)- 3,5,7-trihydroxy-;2-(2,6-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one | | CAS: | 92519-95-4 | | MF: | C15H10O7 | | MW: | 302.24 | | EINECS: | | | Product Categories: | | | Mol File: | 92519-95-4.mol |  |
| | Viscidulin I Chemical Properties |
| Melting point | 296 °C (decomp) | | Boiling point | 588.3±50.0 °C(Predicted) | | density | 1.799±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | water: slightly soluble | | form | solid | | pka | 6.28±0.40(Predicted) | | biological source | plant | | Water Solubility | water: slightly soluble | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | InChI=1S/C15H10O7/c16-6-4-9(19)12-10(5-6)22-15(14(21)13(12)20)11-7(17)2-1-3-8(11)18/h1-5,16-19,21H | | InChIKey | NULZZCUABWZIRV-UHFFFAOYSA-N | | SMILES | C1(C2=C(O)C=CC=C2O)OC2=CC(O)=CC(O)=C2C(=O)C=1O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Viscidulin I Usage And Synthesis |
| Uses | Viscidulin I is a natural product derived from plant source th at finds application in compound screening libraries, metabolomics, phytochemical, and pharmaceutical research. | | Definition | ChEBI: 2-(2,6-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one is a hydroxyflavan. |
| | Viscidulin I Preparation Products And Raw materials |
|