| Company Name: |
Capot Chemical Co.,Ltd. |
| Tel: |
+8613336195806 |
| Email: |
sales@capot.com |
| Products Intro: |
Product Name:1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole
CAS:953040-54-5
Purity:97%(Min,HPLC) Package:100g;1kg;5kg,10kg,25kg,50kg
|
|
|
|
|
|
| | 1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole Basic information |
| Product Name: | 1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole | | Synonyms: | 1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole;1-Methylpyrrole-3-boronic acid, pinacol ester;1H-Pyrrole, 1-Methyl-3-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-;1H-Pyrrole, 1-Methyl-3-(4...;1-Methyl-1H-pyrrol-3-ylboronic acid pinacol ester;1-methyl-pyrrol-3-ylboronic acid pinacol ester;1-methyl-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole;1-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl) | | CAS: | 953040-54-5 | | MF: | C11H18BNO2 | | MW: | 207.08 | | EINECS: | | | Product Categories: | | | Mol File: | 953040-54-5.mol |  |
| | 1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole Chemical Properties |
| Melting point | 55-58 °C | | Boiling point | 296.9±13.0 °C(Predicted) | | density | 0.99±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Powder | | pka | -2.78±0.70(Predicted) | | color | White to off-white | | InChI | InChI=1S/C11H18BNO2/c1-10(2)11(3,4)15-12(14-10)9-6-7-13(5)8-9/h6-8H,1-5H3 | | InChIKey | SYAMJGBBLFTQTK-UHFFFAOYSA-N | | SMILES | N1(C)C=CC(B2OC(C)(C)C(C)(C)O2)=C1 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | HS Code | 2933998090 |
| | 1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole Usage And Synthesis |
| | 1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole Preparation Products And Raw materials |
|