- Rockphos
-
- $1.00 / 1KG
-
2019-07-06
- CAS:1262046-34-3
- Min. Order: 1UG
- Purity: 98%
- Supply Ability: 1MT
|
| | 2-(Di-tert-butylphosphino)-2',6'-dimethoxybiphenyl Basic information |
| Product Name: | 2-(Di-tert-butylphosphino)-2',6'-dimethoxybiphenyl | | Synonyms: | 2-(Di-tert-butylphosphino)-2',6'-dimethoxybiphenyl;Di-tert-butyl(2',6'-dimethoxy-[1,1'-biphenyl]-2-yl)phosphine;Di-tert-butyl(2',6'-dimethoxy-[1,1'-biphenyl]-2-yl);ditert-butyl-[2-(2,6-dimethoxyphenyl)phenyl]phosphane;(2',6'-Dimethoxy[1,1'-biphenyl]-2-yl)bis(1,1-dimethylethyl)phosphine;Phosphine, (2',6'-dimethoxy[1,1'-biphenyl]-2-yl)bis(1,1-dimethylethyl)-;di-tert-butyl({2',6'-dimethoxy-[1,1'-biphenyl]-2-yl})phosphane;T-BUTYLS-PHOS | | CAS: | 819867-21-5 | | MF: | C22H31O2P | | MW: | 358.45 | | EINECS: | | | Product Categories: | | | Mol File: | 819867-21-5.mol |  |
| | 2-(Di-tert-butylphosphino)-2',6'-dimethoxybiphenyl Chemical Properties |
| Melting point | 139-140 °C | | Boiling point | 426.2±35.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder, crystals or chunks | | color | white to off-white | | InChI | InChI=1S/C22H31O2P/c1-21(2,3)25(22(4,5)6)19-15-10-9-12-16(19)20-17(23-7)13-11-14-18(20)24-8/h9-15H,1-8H3 | | InChIKey | JJPUFWFLYXQTEU-UHFFFAOYSA-N | | SMILES | P(C1=CC=CC=C1C1=C(OC)C=CC=C1OC)(C(C)(C)C)C(C)(C)C |
| | 2-(Di-tert-butylphosphino)-2',6'-dimethoxybiphenyl Usage And Synthesis |
| Chemical Properties | The palladium complexes of 2-(Di-tert-butylphosphino)-2',6'-dimethoxybiphenyl exhibit high activity for Suzuki coupling reactions involving aryl chlorides, which are unreactive with palladium complexes of many other phosphine ligands.
| | Uses |
2-ditertbutylphosphino-2′,6′-dimethoxybiphenyl is an electron-rich biaryl phosphine ligand to enhance the reactivity of palladium catalysis during cross-coupling reaction.
| | Uses | suzuki reaction |
| | 2-(Di-tert-butylphosphino)-2',6'-dimethoxybiphenyl Preparation Products And Raw materials |
|