| Company Name: |
Cochemical Ltd. Gold |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
5-Bromo-3-fluoro-2-(hydroxymethyl)pyridine manufacturers
|
| | 5-Bromo-3-fluoro-2-(hydroxymethyl)pyridine Basic information |
| Product Name: | 5-Bromo-3-fluoro-2-(hydroxymethyl)pyridine | | Synonyms: | 5-Bromo-3-fluoro-2-(hydro...;5-BroMo-3-fluoro-2-(hydroxyMethyl)pyridine;(5-Bromo-3-fluoro-2-pyridyl)methanol;2-Pyridinemethanol, 5-bromo-3-fluoro-;5-Bromo-3-fluoro-2-pyridinemethanol;(5-broMo-3-fluoropyridin-2-yl)Methanol | | CAS: | 1206968-92-4 | | MF: | C6H5BrFNO | | MW: | 206.01 | | EINECS: | | | Product Categories: | | | Mol File: | 1206968-92-4.mol |  |
| | 5-Bromo-3-fluoro-2-(hydroxymethyl)pyridine Chemical Properties |
| Boiling point | 245.8±35.0 °C(Predicted) | | density | 1.762±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 12.35±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C6H5BrFNO/c7-4-1-5(8)6(3-10)9-2-4/h1-2,10H,3H2 | | InChIKey | NPFXRHRCWLBISH-UHFFFAOYSA-N | | SMILES | C1(CO)=NC=C(Br)C=C1F |
| | 5-Bromo-3-fluoro-2-(hydroxymethyl)pyridine Usage And Synthesis |
| Synthesis | The general procedure for the synthesis of (5-bromo-3-fluoropyridin-2-yl)methanol using 5-bromo-3-fluoro-2-pyridinecarboxylic acid methyl ester as starting material was as follows: 5-bromo-3-fluoro-2-pyridinecarboxylic acid methyl ester (12.82 mmol) was dissolved in anhydrous ethanol (50.0 mL), followed by addition of sodium borohydride (64.1 mmol). The resulting suspension was heated to reflux and the reaction was maintained for 4 hours and then cooled to room temperature. The reaction mixture was concentrated under reduced pressure to remove the solvent and the residue was diluted with a mixture of saturated aqueous sodium bicarbonate and brine and subsequently extracted with ethyl acetate. The organic phases were combined, dried with anhydrous sodium sulfate, filtered and silica gel powder (about 3 g) was added and evaporated to dryness under reduced pressure. Purification by silica gel column chromatography (eluent: 10% ethyl acetate solution of hexane) afforded the target product (5-bromo-3-fluoropyridin-2-yl)methanol (2.27 g, 82% yield) as a white solid. Mass spectrum (electrospray ionization, positive ion mode) m/z: 205.9, 207.7 [M + H]+. 1H NMR (400 MHz, DMSO-d6) δ ppm: 4.55 (dd, J = 6.06, 2.27 Hz, 2H), 5.40 (t, J = 6.06 Hz, 1H), 8.15 (dd, J = 9.35, 1.77 Hz, 1H), 8.52-8.57 (m, 1H). | | References | [1] Patent: WO2014/8223, 2014, A2. Location in patent: Page/Page column 133-134 |
| | 5-Bromo-3-fluoro-2-(hydroxymethyl)pyridine Preparation Products And Raw materials |
|