|
|
| | N-ALPHA-BENZOYL-L-ARGININE Basic information |
| | N-ALPHA-BENZOYL-L-ARGININE Chemical Properties |
| Melting point | 281-286 °C | | Boiling point | 421.13°C (rough estimate) | | density | 1.1713 (rough estimate) | | refractive index | 1.6120 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.76±0.10(Predicted) | | InChI | InChI=1S/C13H18N4O3/c14-13(15)16-8-4-7-10(12(19)20)17-11(18)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2,(H,17,18)(H,19,20)(H4,14,15,16)/t10-/m0/s1 | | InChIKey | RSYYQCDERUOEFI-JTQLQIEISA-N | | SMILES | C(O)(=O)[C@H](CCCNC(N)=N)NC(=O)C1=CC=CC=C1 | | CAS DataBase Reference | 154-92-7(CAS DataBase Reference) |
| | N-ALPHA-BENZOYL-L-ARGININE Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | N-α-Benzoyl-L-arginine can be used as as growth inhibitors in microbial antitumor screen. | | Definition | ChEBI: N-benzoyl-L-arginine is an N-acyl-L-arginine that is L-arginine in which one of the hydrogens attached to the alpha-amino group has been replaced by a benzoyl group. It is a N-acyl-L-arginine and a member of benzamides. It is functionally related to a benzoic acid. It is an enantiomer of a N-benzoyl-D-arginine. |
| | N-ALPHA-BENZOYL-L-ARGININE Preparation Products And Raw materials |
|