|
|
| | D-Proline, 2-methyl-, hydrochloride Basic information |
| Product Name: | D-Proline, 2-methyl-, hydrochloride | | Synonyms: | D-Proline, 2-methyl-, hydrochloride;D-Proline, 2-Methyl-, hydrochloride (9CI);2-METHYL-D-PROLINE HCL;D-Proline, 2-methyl-, hydrochloride (1:1);(R)-2-Methylpyrrolidine-2-carboxylic acid hydrochloride , H-D-α-Me-Pro-OH·HCl;D-α-Me-Pro-OH·HCl;(2R)-2-methylpyrrolidine-2-carboxylic acid hydrochloride;(R)-2-Methylpyrrolidine-2-carboxylic acid hydrochloride | | CAS: | 123053-48-5 | | MF: | C6H12ClNO2 | | MW: | 166 | | EINECS: | | | Product Categories: | | | Mol File: | 123053-48-5.mol |  |
| | D-Proline, 2-methyl-, hydrochloride Chemical Properties |
| storage temp. | Store at room temperature | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1/C6H11NO2.ClH/c1-6(5(8)9)3-2-4-7-6;/h7H,2-4H2,1H3,(H,8,9);1H/t6-;/s3 | | InChIKey | YWPABDPNGQMUFH-UZHXKHNSNA-N | | SMILES | C(O)(=O)[C@@]1(C)CCCN1.[H]Cl |&1:3,r| |
| | D-Proline, 2-methyl-, hydrochloride Usage And Synthesis |
| | D-Proline, 2-methyl-, hydrochloride Preparation Products And Raw materials |
|