4-Pyrimidineacetic acid ethyl ester manufacturers
|
| | 4-Pyrimidineacetic acid ethyl ester Basic information |
| Product Name: | 4-Pyrimidineacetic acid ethyl ester | | Synonyms: | ethyl 2-(pyriMidin-4-yl)acetate;Methyl 2-(pyriMidin-4-yl)acetate;4-Pyrimidineacetic acid ethyl ester;PyriMidin-4-Yl-Acetic Acid Ethyl Ester;4-Pyrimidineacetic acid ethyl ester ISO 9001：2015 REACH;Ethyl 4-pyrimidinylacetate;4-pyrimidine ethyl acetate;Ethyl 2-(pyrimidin-4-yl)acetate - [E70745] | | CAS: | 1240606-58-9 | | MF: | C8H10N2O2 | | MW: | 166.18 | | EINECS: | | | Product Categories: | Intermediates | | Mol File: | 1240606-58-9.mol |  |
| | 4-Pyrimidineacetic acid ethyl ester Chemical Properties |
| Boiling point | 256℃ | | density | 1.144 | | Fp | 109℃ | | storage temp. | Sealed in dry,Room Temperature | | pka | 1.44±0.10(Predicted) | | Appearance | Light yellow to yellow Liquid | | InChI | InChI=1S/C8H10N2O2/c1-2-12-8(11)5-7-3-4-9-6-10-7/h3-4,6H,2,5H2,1H3 | | InChIKey | MYZVJNQHRQQRRV-UHFFFAOYSA-N | | SMILES | C1=NC=CC(CC(OCC)=O)=N1 |
| | 4-Pyrimidineacetic acid ethyl ester Usage And Synthesis |
| | 4-Pyrimidineacetic acid ethyl ester Preparation Products And Raw materials |
|