- Amino-PEG6-COOtBu
-
- $0.00 / 250mg
-
2024-03-23
- CAS:1286281-32-0
- Min. Order: 250mg
- Purity: >98.00%
- Supply Ability: 250mg
|
| | H2N-PEG6-tBu Basic information |
| | H2N-PEG6-tBu Chemical Properties |
| Boiling point | 475.9±40.0 °C(Predicted) | | density | 1.056±0.06 g/cm3(Predicted) | | refractive index | n/D 1.4562 | | storage temp. | -20°C | | pka | 8.74±0.10(Predicted) | | form | Oil | | color | Colorless to light yellow | | InChI | InChI=1S/C19H39NO8/c1-19(2,3)28-18(21)4-6-22-8-10-24-12-14-26-16-17-27-15-13-25-11-9-23-7-5-20/h4-17,20H2,1-3H3 | | InChIKey | QGSFECNPSLZGGT-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)CCOCCOCCOCCOCCOCCOCCN |
| | H2N-PEG6-tBu Usage And Synthesis |
| Description | Amino-PEG6-t-butyl ester is a PEG reagent containing an amino NH2 group with a t-butyl protected carboxyl group (Boc). The hydrophilic PEG spacer increases solubility in aqueous media. The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The t-butyl protected carboxyl group can be deprotected under acidic conditions. | | Uses | This heterobifunctional, PEGylated crosslinker features an amino group at one end and t-butyl-protected carboxyl group at the other, which can be deprotected with acidic conditions. The hydrophillic PEG linker facilitates solubility in biological applications. Amino-PEG6-t-butyl ester can be used for bioconjugation or as a building block for synthesis of small molecules, conjugates of small molecules and/or biomolecules, or other tool compounds for chemical biology and medicinal chemistry that require ligation. Examples of applications include its synthetic incorporation into antibody-drug conjugates or proteolysis-targeting chimeras (PROTAC? molecules) for targeted protein degradation. | | reaction suitability | reagent type: cross-linking reagent | | IC 50 | PEGs; Alkyl/ether; Non-cleavable Linker |
| | H2N-PEG6-tBu Preparation Products And Raw materials |
|