|
|
| | 2-BroMo-3,6-difluorobenzaldehyde, 96% Basic information |
| Product Name: | 2-BroMo-3,6-difluorobenzaldehyde, 96% | | Synonyms: | 2-BroMo-3,6-difluorobenzaldehyde, 96%;Benzaldehyde, 2-broMo-3,6-difluoro-;EOS-61656;2-BroMo-3,6-difluorobenzaldehyde, 96% ISO 9001:2015 REACH;2-Bromo-3,6-difluorobenzaldehyd;2-bromo-3,6-difluoro-benzaldehyde - [B87973];2-Bromo-3,6-difluorobenzaldehyde | | CAS: | 934987-26-5 | | MF: | C7H3BrF2O | | MW: | 221 | | EINECS: | | | Product Categories: | | | Mol File: | 934987-26-5.mol |  |
| | 2-BroMo-3,6-difluorobenzaldehyde, 96% Chemical Properties |
| Melting point | 49-51℃ | | Boiling point | 224℃ | | density | 1.758 | | Fp | 90℃ | | storage temp. | Store at 0-8 °C | | Appearance | yellow solid | | Sensitive | Air Sensitive | | InChI | InChI=1S/C7H3BrF2O/c8-7-4(3-11)5(9)1-2-6(7)10/h1-3H | | InChIKey | PQXMBFZKKQNHBA-UHFFFAOYSA-N | | SMILES | C(=O)C1=C(F)C=CC(F)=C1Br |
| | 2-BroMo-3,6-difluorobenzaldehyde, 96% Usage And Synthesis |
| Uses | 2-Bromo-3,6-difluorobenzaldehyde is used as an organic chemical synthesis intermediate. |
| | 2-BroMo-3,6-difluorobenzaldehyde, 96% Preparation Products And Raw materials |
|