|
|
| | 7-Bromo-1H-pyrazolo[4,3-c]pyridine Basic information |
| | 7-Bromo-1H-pyrazolo[4,3-c]pyridine Chemical Properties |
| Boiling point | 357.5±22.0 °C(Predicted) | | density | 1.894±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 9.46±0.40(Predicted) | | Appearance | yellow solid | | InChI | InChI=1S/C6H4BrN3/c7-5-3-8-1-4-2-9-10-6(4)5/h1-3H,(H,9,10) | | InChIKey | AIFRKKWUAVZXQP-UHFFFAOYSA-N | | SMILES | C1=NC=C(Br)C2NN=CC1=2 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 7-Bromo-1H-pyrazolo[4,3-c]pyridine Usage And Synthesis |
| Uses | 7-Bromo-1H-pyrazolo[4,3-c]pyridine is used as a pharmaceutical intermediate. It can be used in the preparation of pyrazolylsulphonamide compounds. | | Synthesis | Preparation of 7-bromo-1H-pyrazolo[4,3-c]pyridine (compound 70a): To a solution of 5-bromo-4-chloro-pyridine-3-carbaldehyde (15 g, 68.04 mmol) in DMSO (300 mL) was added hydrazine hydrate (13.7 mL, 276.62 mmol) at 0 °C. The reaction was stirred at 130 °C for 16 hrs. The reaction was cooled and quenched with ice-water (1000 mL). The collected solid was washed with water (100 mL × 3) and concentrated to give compound 70a (12 g) as a white solid. LCMS (M+H)+: 198.
![Synthesis of 7-BROMO-1H-PYRAZOLO[4,3-C]PYRIDINE](/NewsImg/2026-08-24/6392317414461233225356131.png "Synthesis of 7-BROMO-1H-PYRAZOLO[4,3-C]PYRIDINE") |
| | 7-Bromo-1H-pyrazolo[4,3-c]pyridine Preparation Products And Raw materials |
|