|
|
| | Tris(pyrrolidinophosphine) oxide Basic information |
| Product Name: | Tris(pyrrolidinophosphine) oxide | | Synonyms: | LABOTEST-BB LT00847654;PHOSPHORIC ACID TRIPYRROLIDIDE;TRIS(PYRROLIDINO)PHOSPHINE OXIDE;TRIS(N,N-TETRAMETHYLENE)PHOSPHORIC ACID TRIAMIDE;TRIPYRROLIDINOPHOSPHINE OXIDE;Tri(N,N-tetra-Methylene) Phosphor Amide;TRIS(N N-TETRAMETHYLENE)PHOSPHORIC ACID TRIAMIDE 98+%;1,1',1''-Phosphinylidynetripyrrolidine | | CAS: | 6415-07-2 | | MF: | C12H24N3OP | | MW: | 257.32 | | EINECS: | 229-118-2 | | Product Categories: | | | Mol File: | 6415-07-2.mol |  |
| | Tris(pyrrolidinophosphine) oxide Chemical Properties |
| Boiling point | 140-142 °C/0.1 mmHg (lit.) | | density | 1.120 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.514 | | Fp | 113 ºC | | storage temp. | Inert atmosphere,Room Temperature | | pka | 6.89±0.20(Predicted) | | form | clear liquid | | color | Colorless to Brown | | InChI | InChI=1S/C12H24N3OP/c16-17(13-7-1-2-8-13,14-9-3-4-10-14)15-11-5-6-12-15/h1-12H2 | | InChIKey | GQOGEHIVQIMJMO-UHFFFAOYSA-N | | SMILES | P(N1CCCC1)(N1CCCC1)(N1CCCC1)=O | | CAS DataBase Reference | 6415-07-2(CAS DataBase Reference) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 29339900 | | Storage Class | 10 - Combustible liquids |
| | Tris(pyrrolidinophosphine) oxide Usage And Synthesis |
| Chemical Properties | Clear light yellow liquid | | Uses | Tris(N,N-tetramethylene)phosphoric Acid Triamide is a competitive inhibitor of horse serum butyrylcholinesterase. |
| | Tris(pyrrolidinophosphine) oxide Preparation Products And Raw materials |
|