|
|
| | Methyl 3,6-dichloro-5-Methylpyridazine-4-carboxylate Basic information |
| | Methyl 3,6-dichloro-5-Methylpyridazine-4-carboxylate Chemical Properties |
| Boiling point | 361.0±37.0 °C(Predicted) | | density | 1.435±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -2.71±0.10(Predicted) | | form | solid | | Appearance | white solid | | InChI | InChI=1S/C7H6Cl2N2O2/c1-3-4(7(12)13-2)6(9)11-10-5(3)8/h1-2H3 | | InChIKey | PYKFCNHSDFTGQE-UHFFFAOYSA-N | | SMILES | C1(Cl)=NN=C(Cl)C(C)=C1C(OC)=O |
| Storage Class | 11 - Combustible Solids |
| | Methyl 3,6-dichloro-5-Methylpyridazine-4-carboxylate Usage And Synthesis |
| Uses | Methyl 3,6-dichloro-5-methylpyridazine-4-carboxylate is a useful reactant for the preparation of thienodipyridinamines and pyridothienopyridiazinamines which acts as a positive allosteric modulators of the muscarinic acetylcholine receptor M4. |
| | Methyl 3,6-dichloro-5-Methylpyridazine-4-carboxylate Preparation Products And Raw materials |
|