|
|
| | (R)-(-)-1-[(S)-2-(DICYCLOHEXYLPHOSPHINO)FERROCENYL]ETHYLDI-T-BUTYLPHOSPHINE Basic information | | Reaction |
| Product Name: | (R)-(-)-1-[(S)-2-(DICYCLOHEXYLPHOSPHINO)FERROCENYL]ETHYLDI-T-BUTYLPHOSPHINE | | Synonyms: | (R)-1-[(S)-2-(Dicyclohexylphosphino)ferrocenyl]ethyli-tert-butylphosphine;(R)-(S)-cy2PF-PtBu2;(R)-1-[(SP)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldi-tert-butylphosphine;Ferrocene,1-[(1R)-1-[bis(1,1-dimethylethyl)phosphino]ethyl]-2-(dicyclohexylphosphino)-,(2R)-;(R)-1-[(SP)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldi-tert-butylphosphine >=97%;(Dicyclohexylphosphino)ferrocenyl]ethyldi-t-butylphosphine;Josiphos SL-J009-1 / (R)-1-[(S)-2-(Dicyclohexylphosphino)ferrocenyl]ethyli-tert-butylphosphine;(R)-(-)-1-[(S)-2-(Dicyclohexylphosphino)ferrocenyl] ethyldi-t-butylphosphine, min. 97% | | CAS: | 158923-11-6 | | MF: | C32H52FeP2 10* | | MW: | 554.55 | | EINECS: | 238-086-9 | | Product Categories: | organophosphine ligand;Chiral Phosphine;Ferrocene Series;Josiphos Series | | Mol File: | 158923-11-6.mol | ![(R)-(-)-1-[(S)-2-(DICYCLOHEXYLPHOSPHINO)FERROCENYL]ETHYLDI-T-BUTYLPHOSPHINE Structure](CAS/GIF/158923-11-6.gif) |
| | (R)-(-)-1-[(S)-2-(DICYCLOHEXYLPHOSPHINO)FERROCENYL]ETHYLDI-T-BUTYLPHOSPHINE Chemical Properties |
| Melting point | 118-120oC | | alpha | -185° ±10° (c 0.5, CHCl3) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Methanol (Very Slightly) | | form | Powder | | color | orange | | InChIKey | FFFWTQLOUUWUJJ-MGIYCFTINA-N | | SMILES | [Fe].[CH]1[CH][CH][C](P(C2CCCCC2)C2CCCCC2)[C]1[C@H](P(C(C)(C)C)C(C)(C)C)C.[CH]1[CH][CH][CH][CH]1 |&1:19,r,^1:1,2,3,4,18,30,31,32,33,34| |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | (R)-(-)-1-[(S)-2-(DICYCLOHEXYLPHOSPHINO)FERROCENYL]ETHYLDI-T-BUTYLPHOSPHINE Usage And Synthesis |
| Reaction |
- Ligand for Palladium-catalyzed C-N cross-coupling.
- Ligand for Palladium-catalyzed C-S cross-coupling.
- Ligand for Palladium-catalyzed Kumada couplings of aryl and vinyl tosylates.
- Ligand for Rhodium-catalyzed hydroacylation of cyclopropenes, an enatioselective desymmetrization method.
- Ligand for Palladium-catalyzed C-O cross-coupling.
- Ligand for Rhodium-catalyzed coupling of imidazole derivatives with terminal allenes.
- Ligand for Ruthenium-catalyzed C-C coupling of alkynes and alcohols to form branched products of carbonyl allylation


| | Chemical Properties | Orange powder | | Uses | It may be used as a ligand in the palladium catalyzed hetero cross-coupling between aryl bromides/aryl triflates with potassium thioacetate to form S-aryl thioacetates. | | General Description | sold in collaboration with Solvias AG | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand reaction type: Cross Couplings |
| | (R)-(-)-1-[(S)-2-(DICYCLOHEXYLPHOSPHINO)FERROCENYL]ETHYLDI-T-BUTYLPHOSPHINE Preparation Products And Raw materials |
|