| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
ω-3 Arachidonic Acid ethyl ester manufacturers
|
| | ω-3 Arachidonic Acid ethyl ester Basic information |
| Product Name: | ω-3 Arachidonic Acid ethyl ester | | Synonyms: | ω-3 Arachidonic Acid ethyl ester;ethyl (8Z,11Z,14Z,17Z)-icosatetraenoate;LKBDTOYINRNCSY-AFSLFLIVSA-N;.omega.-3 Arachidonic Acid ethyl ester;(All-Z)-8,11,14,17-Eicosatetraenoic Acid Ethyl Ester;8,11,14,17-Eicosatetraenoic acid, ethyl ester, (8Z,11Z,14Z,17Z)-;(8Z,11Z,14Z,17Z)-ethyl icosa-8,11,14,17-tetraenoate;Eicosapentaenoic Acid Impurity 30 | | CAS: | 123940-93-2 | | MF: | C22H36O2 | | MW: | 332.52 | | EINECS: | | | Product Categories: | | | Mol File: | 123940-93-2.mol |  |
| | ω-3 Arachidonic Acid ethyl ester Chemical Properties |
| Boiling point | 418.1±24.0 °C(Predicted) | | density | 0.899±0.06 g/cm3(Predicted) | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Oil | | color | Colourless to Pale Yellow | | Stability: | Light Sensitive | | InChI | InChI=1S/C22H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h5-6,8-9,11-12,14-15H,3-4,7,10,13,16-21H2,1-2H3/b6-5-,9-8-,12-11-,15-14- | | InChIKey | LKBDTOYINRNCSY-AFSLFLIVSA-N | | SMILES | C(OCC)(=O)CCCCCC/C=C\C/C=C\C/C=C\C/C=C\CC |
| | ω-3 Arachidonic Acid ethyl ester Usage And Synthesis |
| Uses | (All-Z)-8,11,14,17-Eicosatetraenoic Acid Ethyl Ester is an ethyl analog of (all-cis)-8,11,14,17-Eicosatetraenoic Acid (E477900) and it is used in biological studies for two-step enzymic synthesis of docosahexaenoic acid-rich symmetry structured triacylglycerols via 2-monoactlglyerols. | | Definition | ChEBI: A long-chain fatty acid ethyl ester resulting from the formal condensation of the carboxy group of (8Z,11Z,14Z,17Z)-icosatetraenoic acid with the hydroxy group of ethanol. |
| | ω-3 Arachidonic Acid ethyl ester Preparation Products And Raw materials |
|