| Company Name: |
BioBioPha Co., Ltd.
|
| Tel: |
0871-65217109 13211707573; |
| Email: |
y.liu@mail.biobiopha.com |
| Products Intro: |
Product Name:Altholactone
CAS:65408-91-5
Purity:95.0% Package:5mg Remarks:BBP02597
|
|
| | Altholactone Basic information |
| Product Name: | Altholactone | | Synonyms: | Altholactone;(+)-Goniothalenol;D-xylo-Hept-2-enonic acid, 4,7-anhydro-2,3-dideoxy-7-C-phenyl-, δ-lactone, (7R)-;2-Phenyl-3-hydroxy-6,7-dihydro-furano-pyrone;Goniothalenol | | CAS: | 65408-91-5 | | MF: | C13H12O4 | | MW: | 232.23 | | EINECS: | | | Product Categories: | | | Mol File: | 65408-91-5.mol |  |
| | Altholactone Chemical Properties |
| Melting point | 108-109 °C(Solv: ethanol (64-17-5); benzene (71-43-2)) | | Boiling point | 490.4±45.0 °C(Predicted) | | density | 1.336±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 12.82±0.40(Predicted) | | form | solid | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C13H12O4/c14-10-7-6-9-13(17-10)11(15)12(16-9)8-4-2-1-3-5-8/h1-7,9,11-13,15H/t9-,11+,12+,13+/m0/s1 | | InChIKey | ZKIRVBNLJKGIEM-WKSBVSIWSA-N | | SMILES | O[C@H]1[C@@H]2OC(=O)C=C[C@@H]2O[C@@H]1c3ccccc3 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | Altholactone Usage And Synthesis |
| Uses | metabolomics
vitamins, nutraceuticals, and natural products | | Definition | ChEBI: Goniothalenol is a furopyran. |
| | Altholactone Preparation Products And Raw materials |
|