|
|
| | 5-chloropyridine-3-sulfonyl chloride Basic information |
| Product Name: | 5-chloropyridine-3-sulfonyl chloride | | Synonyms: | 5-chloropyridine-3-sulfonyl chloride;Vonoprazan Impurity 22;5-Chloro-3-pyridinesulfonyl Chloride;Vonoprazan Impurity 36;TAK438 Impurity 37;Vonoprazan-30;Vonoprazan Fumarate Impurity 71;Vonoprazan impurity 48/5-chloropyridine-3-sulfonyl chloride | | CAS: | 1060802-18-7 | | MF: | C5H3Cl2NO2S | | MW: | 212.05 | | EINECS: | | | Product Categories: | | | Mol File: | 1060802-18-7.mol |  |
| | 5-chloropyridine-3-sulfonyl chloride Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H3Cl2NO2S/c6-4-1-5(3-8-2-4)11(7,9)10/h1-3H | | InChIKey | FQNDXOOGXYFWHZ-UHFFFAOYSA-N | | SMILES | C1=NC=C(Cl)C=C1S(Cl)(=O)=O |
| | 5-chloropyridine-3-sulfonyl chloride Usage And Synthesis |
| Uses | 5-Chloro-3-pyridinesulfonyl Chloride is used as a reagent to prepare proton pump inhibitors such as Tetrahydrocyclopentapyrroles. |
| | 5-chloropyridine-3-sulfonyl chloride Preparation Products And Raw materials |
|