|
|
| | 1H-Indazole,4-broMo-6-nitro- Basic information |
| | 1H-Indazole,4-broMo-6-nitro- Chemical Properties |
| Boiling point | 420.8±25.0 °C(Predicted) | | density | 1.965±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 9.86±0.40(Predicted) | | form | solid | | Appearance | Yellow to orange Solid | | InChI | 1S/C7H4BrN3O2/c8-6-1-4(11(12)13)2-7-5(6)3-9-10-7/h1-3H,(H,9,10) | | InChIKey | MFKKWYOQLIACFO-UHFFFAOYSA-N | | SMILES | [O-][N+](C1=CC(NN=C2)=C2C(Br)=C1)=O |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1H-Indazole,4-broMo-6-nitro- Usage And Synthesis |
| | 1H-Indazole,4-broMo-6-nitro- Preparation Products And Raw materials |
|