| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 9-ethyl-9H-carbazole-3-boronic acid pinacol ester Basic information |
| Product Name: | 9-ethyl-9H-carbazole-3-boronic acid pinacol ester | | Synonyms: | 9-ethyl-9H-carbazole-3-boronic acid pinacol ester;9-Ethyl-3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-9H-carbazole;9-Ethyl-3-carbazolyl boronic acid pinacol ester;9H-Carbazole, 9-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;9-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole;9-Ethyl-9H-carbazole-3-boronic acid pinacol ester;9-Ethyl-9H-Carbazole-3-Boronic Acid Pinaco | | CAS: | 1020657-86-6 | | MF: | C20H24BNO2 | | MW: | 321.22 | | EINECS: | | | Product Categories: | | | Mol File: | 1020657-86-6.mol |  |
| | 9-ethyl-9H-carbazole-3-boronic acid pinacol ester Chemical Properties |
| Melting point | 115-120°C | | Boiling point | 426.8±27.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | form | solid | | Appearance | Off-white to light yellow Solid | | InChI | 1S/C20H24BNO2/c1-6-22-17-10-8-7-9-15(17)16-13-14(11-12-18(16)22)21-23-19(2,3)20(4,5)24-21/h7-13H,6H2,1-5H3 | | InChIKey | WZHQDHUWGUPVQF-UHFFFAOYSA-N | | SMILES | CCn1c2ccccc2c3cc(ccc13)B4OC(C)(C)C(C)(C)O4 |
| WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | 9-ethyl-9H-carbazole-3-boronic acid pinacol ester Usage And Synthesis |
| | 9-ethyl-9H-carbazole-3-boronic acid pinacol ester Preparation Products And Raw materials |
|