|
|
| | Ethanone, 1-(4,6-dichloro-3-pyridinyl)- Basic information |
| Product Name: | Ethanone, 1-(4,6-dichloro-3-pyridinyl)- | | Synonyms: | Ethanone, 1-(4,6-dichloro-3-pyridinyl)-;1-(4,6-Dichloropyridin-3-yl)ethanone;5-Acetyl-2,4-dichloropyridine;1-(4,6-dichloro-3-pyridinyl)-Ethanone;3-Acetyl-4,6-dichloropyridine;1-(4,6-Dichloropyridin-3-yl)ethan-1-one | | CAS: | 887573-44-6 | | MF: | C7H5Cl2NO | | MW: | 190.03 | | EINECS: | | | Product Categories: | | | Mol File: | 887573-44-6.mol |  |
| | Ethanone, 1-(4,6-dichloro-3-pyridinyl)- Chemical Properties |
| Boiling point | 275.3±35.0 °C(Predicted) | | density | 1.376±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -1.28±0.10(Predicted) | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C7H5Cl2NO/c1-4(11)5-3-10-7(9)2-6(5)8/h2-3H,1H3 | | InChIKey | CUSJXLAXSOGBJJ-UHFFFAOYSA-N | | SMILES | C(=O)(C1=C(Cl)C=C(Cl)N=C1)C |
| | Ethanone, 1-(4,6-dichloro-3-pyridinyl)- Usage And Synthesis |
| | Ethanone, 1-(4,6-dichloro-3-pyridinyl)- Preparation Products And Raw materials |
|