- Palbociclib Impurity 15
-
- $0.00 / 10mg
-
2025-09-25
- CAS:1082876-26-3
- Min. Order: 10mg
- Purity: 98%
- Supply Ability: 500mg
|
| | 5-(piperazin-1-yl)pyridin-2-aMine Basic information |
| Product Name: | 5-(piperazin-1-yl)pyridin-2-aMine | | Synonyms: | Palbociclib-005;5-(piperazin-1-yl)pyridin-2-aMine;5-Piperazin-1-yl-pyridin-2-ylamine;2-Amino-5-(1-piperazinyl)pyridine;5-(1-Piperazinyl)-2-pyridinamine;Palbociclib Impurity 44;Palbociclib impurity 6/5-(piperazin-1-yl)pyridin-2-amine;2-Pyridinamine, 5-(1-piperazinyl)- | | CAS: | 1082876-26-3 | | MF: | C9H14N4 | | MW: | 178.23 | | EINECS: | | | Product Categories: | | | Mol File: | 1082876-26-3.mol |  |
| | 5-(piperazin-1-yl)pyridin-2-aMine Chemical Properties |
| Boiling point | 401.7±40.0 °C(Predicted) | | density | 1.163±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 8.67±0.10(Predicted) | | form | Solid | | color | Pale Brown to Light Brown | | InChI | InChI=1S/C9H14N4/c10-9-2-1-8(7-12-9)13-5-3-11-4-6-13/h1-2,7,11H,3-6H2,(H2,10,12) | | InChIKey | VBBGHNGROGZGHG-UHFFFAOYSA-N | | SMILES | C1(N)=NC=C(N2CCNCC2)C=C1 |
| | 5-(piperazin-1-yl)pyridin-2-aMine Usage And Synthesis |
| Uses | 5-?(1-?Piperazinyl)?-?2-?pyridinamine is a reagent used in the synthesis of anticancer agents. Also is an impurity of Palbociclib (P139900), an experimental drug for the treatment of breast cancer being developed by Pfizer. It is a selective inhibitor of the cyclin-dependent kinases CDK4 and CDK6. |
| | 5-(piperazin-1-yl)pyridin-2-aMine Preparation Products And Raw materials |
|