Methyl 2-thienylacetate manufacturers
- Methyl 2-thienylacetate
-
- $0.00 / 25KG
-
2025-12-01
- CAS:19432-68-9
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
- Methyl 2-thienylacetate
-
- $1.10 / 1g
-
2025-11-18
- CAS:19432-68-9
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
|
| | Methyl 2-thienylacetate Basic information |
| Product Name: | Methyl 2-thienylacetate | | Synonyms: | methyl 2-(thiophen-2-yl)acetate;METHYL 2-THIENYLACETATE;METHYL THIOPHENE-2-ACETATE;2-Thienylacetic acid methyl ester;Methyl thiophen-2-ylacetate;Thien-2-ylacetic acid methyl ester;2-(3-Methylthiophen-2-yl)acetate;methyl 2-thienylacetate:methyl thiophene-2-acetate | | CAS: | 19432-68-9 | | MF: | C7H8O2S | | MW: | 156.2 | | EINECS: | 243-054-2 | | Product Categories: | Heterocyclic Compounds | | Mol File: | 19432-68-9.mol |  |
| | Methyl 2-thienylacetate Chemical Properties |
| Boiling point | 50 °C0.06 mm Hg(lit.) | | density | 1.188 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.523 | | Fp | 100-104°C/14mm | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Appearance | Light brown to brown Liquid | | BRN | 120622 | | InChI | InChI=1S/C7H8O2S/c1-9-7(8)5-6-3-2-4-10-6/h2-4H,5H2,1H3 | | InChIKey | KNKIXYMOHMYZJR-UHFFFAOYSA-N | | SMILES | C1(CC(OC)=O)SC=CC=1 | | CAS DataBase Reference | 19432-68-9(CAS DataBase Reference) |
| | Methyl 2-thienylacetate Usage And Synthesis |
| Uses | Methyl 2-Thiopheneacetate can be used as a substrate for penicillin amidase on Eupergit C. |
| | Methyl 2-thienylacetate Preparation Products And Raw materials |
|