| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:2,4-Dinitrobenzenesulfonic acid hydrate
CAS:698999-22-3
Package:25G,5G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2,4-Dinitrobenzenesulfonic acid hydrate
CAS:698999-22-3
Purity:2,4-Dinitrobenzenesulfonic acid hydrate Package:25G Remarks:556971-25G
|
| Company Name: |
Hubei Chenghai Chemical Co., Ltd
|
| Tel: |
027-59220433 18327245847 |
| Email: |
1400838877@qq.com |
| Products Intro: |
CAS:698999-22-3
Purity:99% HPLC Package:1KG;5KG;25KG
|
| Company Name: |
Jiangsu Aikon Biopharmaceutical R&D co.,Ltd.
|
| Tel: |
025-025-66113011 18626450290 |
| Email: |
cb5@aikonchem.com |
| Products Intro: |
Product Name:2,4-Dinitrobenzenesulfonic acid hydrate
CAS:698999-22-3
Purity:95% Package:1g;5g;10g
|
| Company Name: |
Shaoyuan Technology (Shanghai) Co., Ltd.
|
| Tel: |
021-50795510 4000665055 |
| Email: |
sy-c6@accelachem.com |
| Products Intro: |
Product Name:2,4-Dinitrobenzenesulfonic Acid Hydrate
CAS:698999-22-3
Purity:>=95% Package:5g
|
|
| | 2,4-Dinitrobenzenesulfonic acid hydrate Basic information |
| | 2,4-Dinitrobenzenesulfonic acid hydrate Chemical Properties |
| Melting point | 95-98 °C (lit.) | | storage temp. | 2-8°C, sealed storage, away from moisture | | Appearance | Light yellow to brown Solid | | Water Solubility | Soluble in methanol (2.5% w/v), slightly soluble in water. | | InChI | 1S/C6H4N2O7S/c9-7(10)4-1-2-6(16(13,14)15)5(3-4)8(11)12/h1-3H,(H,13,14,15) | | InChIKey | OVOJUAKDTOOXRF-UHFFFAOYSA-N | | SMILES | OS(=O)(=O)c1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 1759 8/PG 2 | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2,4-Dinitrobenzenesulfonic acid hydrate Usage And Synthesis |
| Uses | 2,4-Dinitrobenzenesulfonic acid hydrate is used to prepare ether-soluble 2,4-dinitrophenyl derivatives of amino alcohols. |
| | 2,4-Dinitrobenzenesulfonic acid hydrate Preparation Products And Raw materials |
|