| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | SR 35021 Basic information |
| Product Name: | SR 35021 | | Synonyms: | N-[2-Butyl-3-[4-[3-(butylaMino)propoxy]benzoyl]-5-benzofuranyl]-MethanesulfonaMide Hydrochloride;SR 35021;N-[2-butyl-3-[4-[3-(butylamino)propoxy]benzoyl]-1-benzofuran-5-yl]methanesulfonamide:hydrochloride;Dronedarone hydrochloride related substances A;Dronedarone USP RC A;Dronedarone Impurity 6(Dronedarone USP RC A);Dronedarone Des-butyl Impurity;Dronedarone USP Related Compound A | | CAS: | 197431-02-0 | | MF: | C27H37ClN2O5S | | MW: | 537.11 | | EINECS: | | | Product Categories: | | | Mol File: | 197431-02-0.mol |  |
| | SR 35021 Chemical Properties |
| storage temp. | -20°C | | solubility | DMF: 30 mg/ml,DMSO: 30 mg/ml,DMSO:PBS (pH 7.2) (1:6): 0.14 mg/ml,Ethanol: 1 mg/ml | | form | A solid | | color | White to light yellow | | Major Application | pharmaceutical (small molecule) | | InChIKey | ZDXBTJLIQYUYSZ-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(Nc1cc2c([o]c(c2C(=O)c3ccc(cc3)OCCCNCCCC)CCCC)cc1)C.Cl |
| WGK Germany | WGK 3 | | HS Code | 2932996560 | | Storage Class | 11 - Combustible Solids |
| | SR 35021 Usage And Synthesis |
| Chemical Properties | Tan Solid | | Uses | A metabolite of Dronedarone (D679445). Dronedarone impurity D. Dronedarone USP Related Compound A. |
| | SR 35021 Preparation Products And Raw materials |
|