|
|
| | BenzeneMethanol, alpha-(phenoxyMethyl)- Basic information | | Uses |
| Product Name: | BenzeneMethanol, alpha-(phenoxyMethyl)- | | Synonyms: | BenzeneMethanol, alpha-(phenoxyMethyl)-;Benzenemethanol, a-(phenoxymethyl)-;Benzenemethanol, α-(phenoxymethyl)-;α-(Phenoxymethyl)benzenemethanol;2-phenoxy-1-phenylethan-1-ol;2-Phenoxy-1-phenylethanol | | CAS: | 4249-72-3 | | MF: | C14H14O2 | | MW: | 214.26 | | EINECS: | 1312995-182-4 | | Product Categories: | | | Mol File: | 4249-72-3.mol |  |
| | BenzeneMethanol, alpha-(phenoxyMethyl)- Chemical Properties |
| Melting point | 61-64 °C | | Boiling point | 371.9±30.0 °C(Predicted) | | density | 1.134±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 13.55±0.20(Predicted) | | color | Off-White to Light Beige | | Optical Rotation | -0.32° (C=1.00 g/100ml,CHCL3) | | InChI | InChI=1S/C14H14O2/c15-14(12-7-3-1-4-8-12)11-16-13-9-5-2-6-10-13/h1-10,14-15H,11H2 | | InChIKey | GSBICRJXEDSPTE-UHFFFAOYSA-N | | SMILES | C1(C(COC2=CC=CC=C2)O)=CC=CC=C1 |
| | BenzeneMethanol, alpha-(phenoxyMethyl)- Usage And Synthesis |
| Uses | 2-Phenoxy-1-phenylethanol is used in preparation of Aniline from lignin by selective catalytic conversion. | | Uses | 2-Phenoxy-1-phenylethanol is used in preparation of Aniline from lignin by selective catalytic conversion. |
| | BenzeneMethanol, alpha-(phenoxyMethyl)- Preparation Products And Raw materials |
|