- Phenylglycylcefalexin
-
- $1.00 / 1KG
-
2020-03-12
- CAS:72528-40-6
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 100kg
|
| | Phenylglycylcefalexin Basic information |
| Product Name: | Phenylglycylcefalexin | | Synonyms: | (6R-trans)-D-2-Phenylglycyl-N-(2-carboxy-3-Methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl)-D-2-phenylglycinaMide;D-Phenylglycyl Cephalexin;Phenylglycylcefalexin;Cefadroxil EP Impurity C:(6R,7R)-7-[[(2R)-2-[[(2R)-2-amino-2-phenylacetyl]amino]-2-phenylacetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;Cefalexin Impurity;Cefalexin impurity C;(6R,7R)-7-[[(2R)-2-[[(2R)-2-Amino-2-phenylacetyl]amino]-2-phenylacetyl] amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;Cefalexin Impurity 3(EP Impurity C) | | CAS: | 72528-40-6 | | MF: | C24H24N4O5S | | MW: | 480.54 | | EINECS: | | | Product Categories: | Amines;Aromatics;Heterocycles;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals;Sulfur & Selenium Compounds | | Mol File: | 72528-40-6.mol |  |
| | Phenylglycylcefalexin Chemical Properties |
| Melting point | >207°C (dec.) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Aqueous Acid (Slightly, Sonicated, Heated), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Pale Beige | | InChIKey | DMRMXTUJVSARRA-BXKYNXKVNA-N | | SMILES | C(NC(=O)[C@H](C1=CC=CC=C1)N)(=O)[C@H](C1=CC=CC=C1)N[C@@H]1C(=O)N2[C@]1([H])SCC(C)=C2C(O)=O |&1:4,13,21,25,r| |
| | Phenylglycylcefalexin Usage And Synthesis |
| Uses | D-Phenylglycyl Cephalexin is an impurity of Cephalexin (C256800). | | Uses | Phenylglycyl Cephalexin (Cefalexin EP Impurity C) is an impurity of Cephalexin (C256800). |
| | Phenylglycylcefalexin Preparation Products And Raw materials |
|