|
|
| | 1H-Pyrrolo[2,3-b]pyridine, 5-chloro-3-iodo-1-(phenylsulfonyl)- Basic information |
| | 1H-Pyrrolo[2,3-b]pyridine, 5-chloro-3-iodo-1-(phenylsulfonyl)- Chemical Properties |
| Boiling point | 541.0±60.0 °C(Predicted) | | density | 1.91±0.1 g/cm3(Predicted) | | pka | -1.82±0.30(Predicted) | | form | solid | | InChI | 1S/C13H8ClIN2O2S/c14-9-6-11-12(15)8-17(13(11)16-7-9)20(18,19)10-4-2-1-3-5-10/h1-8H | | InChIKey | VZXZRNATZJUUQW-UHFFFAOYSA-N | | SMILES | Clc1cnc2n(cc(I)c2c1)S(=O)(=O)c3ccccc3 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 1H-Pyrrolo[2,3-b]pyridine, 5-chloro-3-iodo-1-(phenylsulfonyl)- Usage And Synthesis |
| | 1H-Pyrrolo[2,3-b]pyridine, 5-chloro-3-iodo-1-(phenylsulfonyl)- Preparation Products And Raw materials |
|