3-Nitrophthalhydrazide manufacturers
- 3-Nitrophthalhydrazide
-
- $99.07 / 25Kg/Drum
-
2026-01-04
- CAS:3682-15-3
- Min. Order: 25Kg/Drum
- Purity: 98.00%HPLC
- Supply Ability: 5tons/month
- 3-Nitrophthalhydrazide
-
- $10.70 / 1kg
-
2025-05-26
- CAS:3682-15-3
- Min. Order: 10kg
- Purity: 99%
- Supply Ability: 10000kg
|
| | 3-Nitrophthalhydrazide Basic information | | Uses |
| Product Name: | 3-Nitrophthalhydrazide | | Synonyms: | LABOTEST-BB LT00452959;AURORA KA-3797;2,3-DIHYDRO-5-NITRO-1,4-PHTHALAZINEDIONE;3-NITROPHTHALHYDRAZIDE;3-NITROPHTHALIC HYDRAZIDE;3-NITROPHTHALIC HYDRAZINE;2,3-dihydro-5-nitro-4-phthalazinedione;3-NITROPHTHALIC HYDRAZIDE 96+% | | CAS: | 3682-15-3 | | MF: | C8H5N3O4 | | MW: | 207.14 | | EINECS: | 226-776-2 | | Product Categories: | | | Mol File: | 3682-15-3.mol |  |
| | 3-Nitrophthalhydrazide Chemical Properties |
| Melting point | >300 °C (lit.) | | density | 1.555±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 9.26±0.20(Predicted) | | color | Light yellow to Brown to Dark green | | InChI | InChI=1S/C8H5N3O4/c12-7-4-2-1-3-5(11(14)15)6(4)8(13)10-9-7/h1-3H,(H,9,12)(H,10,13) | | InChIKey | YVOBBFQJMOGQOU-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C([N+]([O-])=O)=CC=C2)C(=O)NN1 | | CAS DataBase Reference | 3682-15-3(CAS DataBase Reference) | | EPA Substance Registry System | 1,4-Phthalazinedione, 2,3-dihydro-5-nitro- (3682-15-3) |
| WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29339900 |
| | 3-Nitrophthalhydrazide Usage And Synthesis |
| Uses | 5-Nitro-2,3-dihydrophthalazine-1,4-dione can be used as heat developable light-sensitive materials. | | Chemical Properties | Yellow powder | | Uses | 3-Nitrophthalhydrazide has been used in the preparation of 3-aminophthalhydrazidate, required for the synthesis of monoacylhydrazidate-coordinated Mn2+ and Pb2+ compounds. |
| | 3-Nitrophthalhydrazide Preparation Products And Raw materials |
|