|
N-SucciniMidyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate Suppliers list
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:N-SucciniMidyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate
CAS:1262770-54-6
Purity:>95% Package:25MG,5MG
|
| Company Name: |
Hangzhou Sage Chemical Co., Ltd.
|
| Tel: |
+86057186818502 13588463833 |
| Email: |
info@sagechem.com |
| Products Intro: |
Product Name:N-SucciniMidyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate
CAS:1262770-54-6
Purity:98% Package:1g;5g;100g;Bulk
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:N-Succinimidyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate
CAS:1262770-54-6
Purity:>95% Package:25MG Remarks:41687-25MG
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58859352 19370895928 |
| Email: |
dt3@aikonchem.com |
| Products Intro: |
Product Name:2,5-Dioxopyrrolidin-1-yl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate
CAS:1262770-54-6
Purity:95% HPLC or GC Package:10G,5G;1G
|
| Company Name: |
Shanghai Fluoking Chemicals Co., Ltd.
|
| Tel: |
21-21-021-31009277 13918871782;13761216778 |
| Email: |
fluoking@fluoking.com |
| Products Intro: |
Product Name:N-SucciniMidyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate
CAS:1262770-54-6
Purity:>98% Package:1kg；5kg;25-100-500kg，1-10T
|
|
| | N-SucciniMidyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate Basic information |
| Product Name: | N-SucciniMidyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate | | Synonyms: | 4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluor-nonansure-N-succinimidylester;N-Succinimidyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate >95%;Nonanoic acid, 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-, 2,5-dioxo-1-pyrrolidinyl ester;2,5-Dioxopyrrolidin-1-yl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate;N-Succinimidyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate | | CAS: | 1262770-54-6 | | MF: | C13H8F13NO4 | | MW: | 489.19 | | EINECS: | | | Product Categories: | | | Mol File: | 1262770-54-6.mol |  |
| | N-SucciniMidyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate Chemical Properties |
| Melting point | 127-131°C | | storage temp. | -20°C | | InChI | 1S/C13H8F13NO4/c14-8(15,4-3-7(30)31-27-5(28)1-2-6(27)29)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h1-4H2 | | InChIKey | ATDSDUMFZUDFRA-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(=O)ON1C(=O)CCC1=O | | EPA Substance Registry System | 1-[(4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluorononanoyl)oxy]pyrrolidine-2,5-dione (1262770-54-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | N-SucciniMidyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate Usage And Synthesis |
| | N-SucciniMidyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate Preparation Products And Raw materials |
|